C17H27NO2 — CID 162963749
(1S,3R,8R,9R,12S,14R,16R)-16-hydroxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadecan-10-one (PubChem CID 162963749) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (1S,3R,8R,9R,12S,14R,16R)-16-hydroxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadecan-10-one.
| Compound Name | (1S,3R,8R,9R,12S,14R,16R)-16-hydroxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadecan-10-one |
|---|---|
| PubChem CID | 162963749 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (1S,3R,8R,9R,12S,14R,16R)-16-hydroxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadecan-10-one |
| SMILES | C[C@@H]1C[C@H]2CC(=O)[C@@H]3[C@@H]4CCN(C)C[C@@H]4C[C@]23[C@H](O)C1 |
| InChI | InChI=1S/C17H27NO2/c1-10-5-12-7-14(19)16-13-3-4-18(2)9-11(13)8-17(12,16)15(20)6-10/h10-13,15-16,20H,3-9H2,1-2H3/t10-,11+,12+,13-,15-,16+,17-/m1/s1 |
| InChIKey | FXQAQYFSGHGITP-MWPPTBCWSA-N |
| XLogP | 1.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |