C30H44N2O — CID 162966274
(1S,2R,6E,9Z,12E,18S,19R,20R,27E)-16,22-diazapentacyclo[14.14.1.13,20.01,19.02,22]dotriaconta-3(32),6,9,12,27-pentaen-18-ol (PubChem CID 162966274) has the molecular formula C30H44N2O and a molecular weight of 448.70 g/mol. Its IUPAC name is (1S,2R,6E,9Z,12E,18S,19R,20R,27E)-16,22-diazapentacyclo[14.14.1.13,20.01,19.02,22]dotriaconta-3(32),6,9,12,27-pentaen-18-ol.
| Compound Name | (1S,2R,6E,9Z,12E,18S,19R,20R,27E)-16,22-diazapentacyclo[14.14.1.13,20.01,19.02,22]dotriaconta-3(32),6,9,12,27-pentaen-18-ol |
|---|---|
| PubChem CID | 162966274 |
| Molecular Formula | C30H44N2O |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | (1S,2R,6E,9Z,12E,18S,19R,20R,27E)-16,22-diazapentacyclo[14.14.1.13,20.01,19.02,22]dotriaconta-3(32),6,9,12,27-pentaen-18-ol |
| SMILES | O[C@@H]1CN2CC/C=C/C/C=C\C/C=C/CCC3=C[C@H]4CN5CCCC/C=C\CC[C@@](C2)([C@H]14)[C@@H]35 |
| InChI | InChI=1S/C30H44N2O/c33-27-23-31-19-15-11-7-4-2-1-3-5-9-13-17-25-21-26-22-32-20-16-12-8-6-10-14-18-30(24-31,28(26)27)29(25)32/h1-2,5-7,9-11,21,26-29,33H,3-4,8,12-20,22-24H2/b2-1-,9-5+,10-6-,11-7+/t26-,27+,28-,29+,30+/m0/s1 |
| InChIKey | QESBCAGTXAIIFT-LNLWJOFSSA-N |
| XLogP | 5.66 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|