C26H40N2O — CID 155931158
(1R,3R,10Z,23Z,27R)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-trien-3-ol (PubChem CID 155931158) has the molecular formula C26H40N2O and a molecular weight of 396.62 g/mol. Its IUPAC name is (1R,3R,10Z,23Z,27R)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-trien-3-ol.
| Compound Name | (1R,3R,10Z,23Z,27R)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-trien-3-ol |
|---|---|
| PubChem CID | 155931158 |
| Molecular Formula | C26H40N2O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (1R,3R,10Z,23Z,27R)-5,18-diazapentacyclo[12.12.1.11,5.02,16.018,27]octacosa-10,14,23-trien-3-ol |
| SMILES | OC1CN2CCCC/C=C\CCC3=CC4CN5CCCC/C=C\CC[C@](C2)(C14)[C@@H]35 |
| InChI | InChI=1S/C26H40N2O/c29-23-19-27-15-11-7-3-1-5-9-13-21-17-22-18-28-16-12-8-4-2-6-10-14-26(20-27,24(22)23)25(21)28/h1-2,5-6,17,22-25,29H,3-4,7-16,18-20H2/b5-1-,6-2-/t22?,23?,24?,25-,26+/m1/s1 |
| InChIKey | OMWMVWFWKDXXTO-QBKREDRTSA-N |
| XLogP | 4.55 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|