C31H48N2O — CID 16728497
(14Z,26Z,28Z)-18,24-diazapentacyclo[16.13.1.13,22.01,21.02,24]tritriaconta-3(33),14,26,28-tetraen-30-ol (PubChem CID 16728497) has the molecular formula C31H48N2O and a molecular weight of 464.74 g/mol. Its IUPAC name is (14Z,26Z,28Z)-18,24-diazapentacyclo[16.13.1.13,22.01,21.02,24]tritriaconta-3(33),14,26,28-tetraen-30-ol.
| Compound Name | (14Z,26Z,28Z)-18,24-diazapentacyclo[16.13.1.13,22.01,21.02,24]tritriaconta-3(33),14,26,28-tetraen-30-ol |
|---|---|
| PubChem CID | 16728497 |
| Molecular Formula | C31H48N2O |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | (14Z,26Z,28Z)-18,24-diazapentacyclo[16.13.1.13,22.01,21.02,24]tritriaconta-3(33),14,26,28-tetraen-30-ol |
| SMILES | OC1/C=C\C=C/CN2CC3C=C4CCCCCCCCCC/C=C\CCN5CCC3C(C1)(C5)C42 |
| InChI | InChI=1S/C31H48N2O/c34-28-17-13-11-15-20-33-24-27-22-26-16-12-9-7-5-3-1-2-4-6-8-10-14-19-32-21-18-29(27)31(23-28,25-32)30(26)33/h8,10-11,13,15,17,22,27-30,34H,1-7,9,12,14,16,18-21,23-25H2/b10-8-,15-11-,17-13- |
| InChIKey | ASPMOPRBGPEGOV-QEZAQBRBSA-N |
| XLogP | 6.27 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|