(2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate

C16H20O4 — CID 162967037

IUPAC(2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate
SMILESCC=Cc1cc(OC)c(OC(=O)C(C)=CC)c(OC)c1
InChIInChI=1S/C16H20O4/c1-6-8-12-9-13(18-4)15(14(10-12)19-5)20-16(17)11(3)7-2/h6-10H,1-5H3
InChIKeyWGPUUNUYCNVGDM-UHFFFAOYSA-N
MW276.33 g/mol
LogP3.61
Rot. Bonds5

About (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate

(2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate (PubChem CID 162967037) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate.

Molecular Properties

Compound Name(2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate
PubChem CID162967037
Molecular FormulaC16H20O4
Molecular Weight276.33 g/mol
Exact Mass276.14
IUPAC Name(2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate
SMILESCC=Cc1cc(OC)c(OC(=O)C(C)=CC)c(OC)c1
InChIInChI=1S/C16H20O4/c1-6-8-12-9-13(18-4)15(14(10-12)19-5)20-16(17)11(3)7-2/h6-10H,1-5H3
InChIKeyWGPUUNUYCNVGDM-UHFFFAOYSA-N
XLogP3.61
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.33
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate?
The IUPAC name of (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate (CID 162967037) is (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate.
What is the SMILES notation for (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate?
The canonical SMILES for (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate is CC=Cc1cc(OC)c(OC(=O)C(C)=CC)c(OC)c1.
What is the InChIKey of (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate?
The InChIKey is WGPUUNUYCNVGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4/c1-6-8-12-9-13(18-4)15(14(10-12)19-5)20-16(17)11(3)7-2/h6-10H,1-5H3.
What are the key properties of (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate?
(2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate has a molecular weight of 276.33 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxy-4-prop-1-enylphenyl) 2-methylbut-2-enoate is sourced from PubChem (CID 162967037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).