C24H32O8 — CID 162968004
4-(3,7-dimethylocta-2,6-dienyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one (PubChem CID 162968004) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 162968004 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one |
| SMILES | CC(C)=CCCC(C)=CCc1c(OC2OC(CO)C(O)C(O)C2O)ccc2c1CC(=O)O2 |
| InChI | InChI=1S/C24H32O8/c1-13(2)5-4-6-14(3)7-8-15-16-11-20(26)30-18(16)10-9-17(15)31-24-23(29)22(28)21(27)19(12-25)32-24/h5,7,9-10,19,21-25,27-29H,4,6,8,11-12H2,1-3H3 |
| InChIKey | MAGXMRMOYJEEHN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|