C22H30O10 — CID 162972720
5-(3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione (PubChem CID 162972720) has the molecular formula C22H30O10 and a molecular weight of 454.47 g/mol. Its IUPAC name is 5-(3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione.
| Compound Name | 5-(3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione |
|---|---|
| PubChem CID | 162972720 |
| Molecular Formula | C22H30O10 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 5-(3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl)-12-hydroxy-3,11-dimethyl-6,14-dioxatetracyclo[10.2.2.02,11.03,8]hexadec-15-ene-7,13-dione |
| SMILES | COC1OC(OC)C(O)(C2CC3(C)C(CCC4(C)C3C3C=CC4(O)C(=O)O3)C(=O)O2)C1O |
| InChI | InChI=1S/C22H30O10/c1-19-9-12(22(27)14(23)16(28-3)32-18(22)29-4)31-15(24)10(19)5-7-20(2)13(19)11-6-8-21(20,26)17(25)30-11/h6,8,10-14,16,18,23,26-27H,5,7,9H2,1-4H3 |
| InChIKey | VEJSKYWCJMGHFY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|