C21H32O2 — CID 162975231
(3E,6S,7E,9E)-17-(furan-2-yl)heptadeca-3,7,9-trien-6-ol (PubChem CID 162975231) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (3E,6S,7E,9E)-17-(furan-2-yl)heptadeca-3,7,9-trien-6-ol.
| Compound Name | (3E,6S,7E,9E)-17-(furan-2-yl)heptadeca-3,7,9-trien-6-ol |
|---|---|
| PubChem CID | 162975231 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (3E,6S,7E,9E)-17-(furan-2-yl)heptadeca-3,7,9-trien-6-ol |
| SMILES | CC/C=C/C[C@H](O)/C=C/C=C/CCCCCCCc1ccco1 |
| InChI | InChI=1S/C21H32O2/c1-2-3-11-15-20(22)16-12-9-7-5-4-6-8-10-13-17-21-18-14-19-23-21/h3,7,9,11-12,14,16,18-20,22H,2,4-6,8,10,13,15,17H2,1H3/b9-7+,11-3+,16-12+/t20-/m0/s1 |
| InChIKey | GTXGAFVOCLTKJL-CBJDEKPLSA-N |
| XLogP | 5.99 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|