C20H30O5 — CID 162979029
(2E,5S,6R,10Z,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,10-diene-4,9-dione (PubChem CID 162979029) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2E,5S,6R,10Z,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,10-diene-4,9-dione.
| Compound Name | (2E,5S,6R,10Z,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,10-diene-4,9-dione |
|---|---|
| PubChem CID | 162979029 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2E,5S,6R,10Z,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-2,10-diene-4,9-dione |
| SMILES | CC(C)/C1=C\C2O[C@]2(C)CC/C=C(/CO)C(=O)CC[C@@H](C)[C@H](O)C1=O |
| InChI | InChI=1S/C20H30O5/c1-12(2)15-10-17-20(4,25-17)9-5-6-14(11-21)16(22)8-7-13(3)18(23)19(15)24/h6,10,12-13,17-18,21,23H,5,7-9,11H2,1-4H3/b14-6-,15-10+/t13-,17?,18+,20-/m1/s1 |
| InChIKey | REPYAYNHFYOZHS-INAKZHCLSA-N |
| XLogP | 2.35 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|