C21H32O4 — CID 162981011
(1S,4E,4aS,7E,9R,11aR)-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1,9-diol (PubChem CID 162981011) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1S,4E,4aS,7E,9R,11aR)-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1,9-diol.
| Compound Name | (1S,4E,4aS,7E,9R,11aR)-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1,9-diol |
|---|---|
| PubChem CID | 162981011 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1S,4E,4aS,7E,9R,11aR)-4-[(E)-4-methoxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-1,9-diol |
| SMILES | C=C1C[C@@H](O)/C=C(\C)CC[C@@H]2/C(=C\C=C\C(C)(C)OC)CO[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C21H32O4/c1-14-8-9-18-16(7-6-10-21(3,4)24-5)13-25-20(23)19(18)15(2)12-17(22)11-14/h6-7,10-11,17-20,22-23H,2,8-9,12-13H2,1,3-5H3/b10-6+,14-11+,16-7-/t17-,18+,19-,20-/m0/s1 |
| InChIKey | VFTOIFVTLGVBAQ-OUAGBGQSSA-N |
| XLogP | 3.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|