C23H36O6 — CID 163044443
(1S,4S,6S,7R,10R,11S,13S)-11,13-dimethoxy-14-[(E)-4-methoxy-4-methylpent-2-enylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-7-ol (PubChem CID 163044443) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is (1S,4S,6S,7R,10R,11S,13S)-11,13-dimethoxy-14-[(E)-4-methoxy-4-methylpent-2-enylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-7-ol.
| Compound Name | (1S,4S,6S,7R,10R,11S,13S)-11,13-dimethoxy-14-[(E)-4-methoxy-4-methylpent-2-enylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-7-ol |
|---|---|
| PubChem CID | 163044443 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (1S,4S,6S,7R,10R,11S,13S)-11,13-dimethoxy-14-[(E)-4-methoxy-4-methylpent-2-enylidene]-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-7-ol |
| SMILES | C=C1C[C@@H](O)[C@@H]2O[C@@]2(C)CC[C@@H]2C(=C/C=C/C(C)(C)OC)[C@@H](OC)O[C@H](OC)[C@@H]12 |
| InChI | InChI=1S/C23H36O6/c1-14-13-17(24)19-23(4,29-19)12-10-15-16(9-8-11-22(2,3)27-7)20(25-5)28-21(26-6)18(14)15/h8-9,11,15,17-21,24H,1,10,12-13H2,2-7H3/b11-8+,16-9?/t15-,17-,18+,19+,20+,21+,23+/m1/s1 |
| InChIKey | CBMLJQGGJCPLPJ-YXZPKDENSA-N |
| XLogP | 3.36 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|