C20H28O5 — CID 162879360
(1S,7R,10R)-7-hydroxy-14-(4-hydroxy-4-methylpent-2-enylidene)-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one (PubChem CID 162879360) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,7R,10R)-7-hydroxy-14-(4-hydroxy-4-methylpent-2-enylidene)-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one.
| Compound Name | (1S,7R,10R)-7-hydroxy-14-(4-hydroxy-4-methylpent-2-enylidene)-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one |
|---|---|
| PubChem CID | 162879360 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,7R,10R)-7-hydroxy-14-(4-hydroxy-4-methylpent-2-enylidene)-4-methyl-9-methylidene-5,12-dioxatricyclo[8.4.0.04,6]tetradecan-13-one |
| SMILES | C=C1C[C@@H](O)C2OC2(C)CC[C@@H]2C(=CC=CC(C)(C)O)C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C20H28O5/c1-12-10-16(21)17-20(4,25-17)9-7-13-14(6-5-8-19(2,3)23)18(22)24-11-15(12)13/h5-6,8,13,15-17,21,23H,1,7,9-11H2,2-4H3/t13-,15+,16-,17?,20?/m1/s1 |
| InChIKey | DHTWVKTXQLZELP-WSRZGFJWSA-N |
| XLogP | 2.29 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|