C21H32O5 — CID 162971150
(1R,2S,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-1-methoxy-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradecan-3-one (PubChem CID 162971150) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (1R,2S,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-1-methoxy-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradecan-3-one.
| Compound Name | (1R,2S,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-1-methoxy-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradecan-3-one |
|---|---|
| PubChem CID | 162971150 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1R,2S,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-1-methoxy-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradecan-3-one |
| SMILES | CO[C@@]12CC[C@@H](O)[C@@](C)(CC[C@@H]3/C(=C\C=C\C(C)(C)O)COC(=O)[C@@H]31)C2 |
| InChI | InChI=1S/C21H32O5/c1-19(2,24)9-5-6-14-12-26-18(23)17-15(14)7-10-20(3)13-21(17,25-4)11-8-16(20)22/h5-6,9,15-17,22,24H,7-8,10-13H2,1-4H3/b9-5+,14-6-/t15-,16-,17-,20+,21-/m1/s1 |
| InChIKey | CUFNSNQMTXWTPT-OREVOKJSSA-N |
| XLogP | 2.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |