C20H28O5 — CID 72983419
6-hydroxy-2-(7-hydroxy-6a-methyl-3-oxo-1,3a,4,5,6,7,8,9-octahydrocyclopenta[d][2]benzofuran-4-yl)-6-methylhepta-2,4-dienal (PubChem CID 72983419) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 6-hydroxy-2-(7-hydroxy-6a-methyl-3-oxo-1,3a,4,5,6,7,8,9-octahydrocyclopenta[d][2]benzofuran-4-yl)-6-methylhepta-2,4-dienal.
| Compound Name | 6-hydroxy-2-(7-hydroxy-6a-methyl-3-oxo-1,3a,4,5,6,7,8,9-octahydrocyclopenta[d][2]benzofuran-4-yl)-6-methylhepta-2,4-dienal |
|---|---|
| PubChem CID | 72983419 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 6-hydroxy-2-(7-hydroxy-6a-methyl-3-oxo-1,3a,4,5,6,7,8,9-octahydrocyclopenta[d][2]benzofuran-4-yl)-6-methylhepta-2,4-dienal |
| SMILES | CC(C)(O)C=CC=C(C=O)C1CCC2(C)C(O)CCC23COC(=O)C13 |
| InChI | InChI=1S/C20H28O5/c1-18(2,24)8-4-5-13(11-21)14-6-9-19(3)15(22)7-10-20(19)12-25-17(23)16(14)20/h4-5,8,11,14-16,22,24H,6-7,9-10,12H2,1-3H3 |
| InChIKey | QCUXRKJBHSUAJV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|