About (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one
(4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one (PubChem CID 163040873) has the molecular formula C21H24O4
and a molecular weight of 340.42 g/mol. Its IUPAC name is (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one.
Molecular Properties
| Compound Name | (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one |
| PubChem CID | 163040873 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one |
| SMILES | COC(C)(C)C=CC=C1COc2oc3cccc(C)c3c(=O)c2[C@@H]1C |
| InChI | InChI=1S/C21H24O4/c1-13-8-6-10-16-17(13)19(22)18-14(2)15(12-24-20(18)25-16)9-7-11-21(3,4)23-5/h6-11,14H,12H2,1-5H3/t14-/m1/s1 |
| InChIKey | VQUHBOKDZNFRFJ-CQSZACIVSA-N |
| XLogP | 4.50 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one?
The IUPAC name of (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one (CID 163040873) is (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one.
What is the SMILES notation for (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one?
The canonical SMILES for (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one is COC(C)(C)C=CC=C1COc2oc3cccc(C)c3c(=O)c2[C@@H]1C.
What is the InChIKey of (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one?
The InChIKey is VQUHBOKDZNFRFJ-CQSZACIVSA-N. The full InChI is InChI=1S/C21H24O4/c1-13-8-6-10-16-17(13)19(22)18-14(2)15(12-24-20(18)25-16)9-7-11-21(3,4)23-5/h6-11,14H,12H2,1-5H3/t14-/m1/s1.
What are the key properties of (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one?
(4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one has a molecular weight of 340.42 g/mol, XLogP of 4.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-(4-methoxy-4-methylpent-2-enylidene)-4,6-dimethyl-4H-pyrano[2,3-b]chromen-5-one is sourced from PubChem (CID 163040873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).