C28H46O3 — CID 162984333
(3S,8S,9R,10R,11R,13S,14R,16S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,16-triol (PubChem CID 162984333) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (3S,8S,9R,10R,11R,13S,14R,16S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,16-triol.
| Compound Name | (3S,8S,9R,10R,11R,13S,14R,16S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,16-triol |
|---|---|
| PubChem CID | 162984333 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (3S,8S,9R,10R,11R,13S,14R,16S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,16-triol |
| SMILES | C=C(CC[C@@H](C)[C@H]1[C@@H](O)C[C@@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@@H]3[C@H](O)C[C@]12C)C(C)C |
| InChI | InChI=1S/C28H46O3/c1-16(2)17(3)7-8-18(4)25-23(30)14-22-21-10-9-19-13-20(29)11-12-27(19,5)26(21)24(31)15-28(22,25)6/h9,16,18,20-26,29-31H,3,7-8,10-15H2,1-2,4-6H3/t18-,20+,21+,22-,23+,24-,25+,26+,27+,28+/m1/s1 |
| InChIKey | OAICOSKBQLOMBW-DRTSSBARSA-N |
| XLogP | 5.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|