C16H18O3 — CID 162987690
3-(3-nona-1,7-dien-3,5-diynyloxiran-2-yl)propyl acetate (PubChem CID 162987690) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(3-nona-1,7-dien-3,5-diynyloxiran-2-yl)propyl acetate.
| Compound Name | 3-(3-nona-1,7-dien-3,5-diynyloxiran-2-yl)propyl acetate |
|---|---|
| PubChem CID | 162987690 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3-(3-nona-1,7-dien-3,5-diynyloxiran-2-yl)propyl acetate |
| SMILES | CC=CC#CC#CC=CC1OC1CCCOC(C)=O |
| InChI | InChI=1S/C16H18O3/c1-3-4-5-6-7-8-9-11-15-16(19-15)12-10-13-18-14(2)17/h3-4,9,11,15-16H,10,12-13H2,1-2H3 |
| InChIKey | UVKGCBHCGVVJKF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|