C17H18O6 — CID 162989017
11,14-dihydroxy-12-methoxy-17-methyl-6,8-dioxapentacyclo[7.7.1.02,7.05,17.010,15]heptadeca-10(15),11,13-trien-16-one (PubChem CID 162989017) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 11,14-dihydroxy-12-methoxy-17-methyl-6,8-dioxapentacyclo[7.7.1.02,7.05,17.010,15]heptadeca-10(15),11,13-trien-16-one.
| Compound Name | 11,14-dihydroxy-12-methoxy-17-methyl-6,8-dioxapentacyclo[7.7.1.02,7.05,17.010,15]heptadeca-10(15),11,13-trien-16-one |
|---|---|
| PubChem CID | 162989017 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 11,14-dihydroxy-12-methoxy-17-methyl-6,8-dioxapentacyclo[7.7.1.02,7.05,17.010,15]heptadeca-10(15),11,13-trien-16-one |
| SMILES | COc1cc(O)c2c(c1O)C1OC3OC4CCC3C(C2=O)C41C |
| InChI | InChI=1S/C17H18O6/c1-17-9-4-3-6-12(17)14(20)10-7(18)5-8(21-2)13(19)11(10)15(17)23-16(6)22-9/h5-6,9,12,15-16,18-19H,3-4H2,1-2H3 |
| InChIKey | OTRFGWOUMRJFGT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|