C10H16O2 — CID 162991143
(3R)-5-(2,5-dihydrofuran-3-yl)-2-methylpent-1-en-3-ol (PubChem CID 162991143) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3R)-5-(2,5-dihydrofuran-3-yl)-2-methylpent-1-en-3-ol.
| Compound Name | (3R)-5-(2,5-dihydrofuran-3-yl)-2-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 162991143 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3R)-5-(2,5-dihydrofuran-3-yl)-2-methylpent-1-en-3-ol |
| SMILES | C=C(C)[C@H](O)CCC1=CCOC1 |
| InChI | InChI=1S/C10H16O2/c1-8(2)10(11)4-3-9-5-6-12-7-9/h5,10-11H,1,3-4,6-7H2,2H3/t10-/m1/s1 |
| InChIKey | ZDUOXOIEBYTFJD-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|