C12H22O2 — CID 12836080
3-(4-butyl-3,6-dihydro-2H-pyran-6-yl)propan-1-ol (PubChem CID 12836080) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-(4-butyl-3,6-dihydro-2H-pyran-6-yl)propan-1-ol.
| Compound Name | 3-(4-butyl-3,6-dihydro-2H-pyran-6-yl)propan-1-ol |
|---|---|
| PubChem CID | 12836080 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3-(4-butyl-3,6-dihydro-2H-pyran-6-yl)propan-1-ol |
| SMILES | CCCCC1=CC(CCCO)OCC1 |
| InChI | InChI=1S/C12H22O2/c1-2-3-5-11-7-9-14-12(10-11)6-4-8-13/h10,12-13H,2-9H2,1H3 |
| InChIKey | FWZAFRIKZZQPPN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|