C8H13FO2 — CID 163515887
[(3S,6R)-3-fluoro-6-methoxycyclohexen-1-yl]methanol (PubChem CID 163515887) has the molecular formula C8H13FO2 and a molecular weight of 160.19 g/mol. Its IUPAC name is [(3S,6R)-3-fluoro-6-methoxycyclohexen-1-yl]methanol.
| Compound Name | [(3S,6R)-3-fluoro-6-methoxycyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 163515887 |
| Molecular Formula | C8H13FO2 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | [(3S,6R)-3-fluoro-6-methoxycyclohexen-1-yl]methanol |
| SMILES | CO[C@@H]1CC[C@H](F)C=C1CO |
| InChI | InChI=1S/C8H13FO2/c1-11-8-3-2-7(9)4-6(8)5-10/h4,7-8,10H,2-3,5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | DGRLQMUJHOJTLC-JGVFFNPUSA-N |
| XLogP | 1.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|