C25H30O10 — CID 162997834
(11-ethyl-7-hydroxy-7,14-dimethyl-2-methylidene-3,12-dioxo-4,13,17-trioxatetracyclo[8.6.1.01,5.010,14]heptadec-5-en-16-yl) 2-(acetyloxymethyl)prop-2-enoate (PubChem CID 162997834) has the molecular formula C25H30O10 and a molecular weight of 490.51 g/mol. Its IUPAC name is (11-ethyl-7-hydroxy-7,14-dimethyl-2-methylidene-3,12-dioxo-4,13,17-trioxatetracyclo[8.6.1.01,5.010,14]heptadec-5-en-16-yl) 2-(acetyloxymethyl)prop-2-enoate.
| Compound Name | (11-ethyl-7-hydroxy-7,14-dimethyl-2-methylidene-3,12-dioxo-4,13,17-trioxatetracyclo[8.6.1.01,5.010,14]heptadec-5-en-16-yl) 2-(acetyloxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 162997834 |
| Molecular Formula | C25H30O10 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (11-ethyl-7-hydroxy-7,14-dimethyl-2-methylidene-3,12-dioxo-4,13,17-trioxatetracyclo[8.6.1.01,5.010,14]heptadec-5-en-16-yl) 2-(acetyloxymethyl)prop-2-enoate |
| SMILES | C=C(COC(C)=O)C(=O)OC1CC2(C)OC(=O)C(CC)C23CCC(C)(O)C=C2OC(=O)C(=C)C21O3 |
| InChI | InChI=1S/C25H30O10/c1-7-16-21(29)34-23(6)11-18(32-19(27)13(2)12-31-15(4)26)25-14(3)20(28)33-17(25)10-22(5,30)8-9-24(16,23)35-25/h10,16,18,30H,2-3,7-9,11-12H2,1,4-6H3 |
| InChIKey | TXVVKFYKGUBRGZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|