C24H30O10 — CID 38346727
[(1S,2S,4R,7E,8R,11R)-7-ethylidene-8-hydroxy-1-(3-methoxy-3-oxoprop-1-en-2-yl)-4,11-dimethyl-6,13-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-2-yl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 38346727) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is [(1S,2S,4R,7E,8R,11R)-7-ethylidene-8-hydroxy-1-(3-methoxy-3-oxoprop-1-en-2-yl)-4,11-dimethyl-6,13-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-2-yl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [(1S,2S,4R,7E,8R,11R)-7-ethylidene-8-hydroxy-1-(3-methoxy-3-oxoprop-1-en-2-yl)-4,11-dimethyl-6,13-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-2-yl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 38346727 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(1S,2S,4R,7E,8R,11R)-7-ethylidene-8-hydroxy-1-(3-methoxy-3-oxoprop-1-en-2-yl)-4,11-dimethyl-6,13-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-2-yl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)O[C@H]1C[C@@]2(C)OC(=O)/C(=C/C)[C@]2(O)CC[C@]2(C)CC(=O)[C@@]1(C(=C)C(=O)OC)O2 |
| InChI | InChI=1S/C24H30O10/c1-7-15-20(29)33-22(5)11-17(32-18(27)13(2)12-25)24(14(3)19(28)31-6)16(26)10-21(4,34-24)8-9-23(15,22)30/h7,17,25,30H,2-3,8-12H2,1,4-6H3/b15-7-/t17-,21+,22+,23+,24+/m0/s1 |
| InChIKey | KGEPWHDEEFCDEU-KWIQQZBJSA-N |
| XLogP | 0.84 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|