C27H40O4 — CID 162998975
3-[1-[(4R,10S)-4-[(4-hydroxyphenyl)methyl]-10-methyl-11-oxoundecyl]cyclopentyl]prop-2-enoic acid (PubChem CID 162998975) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 3-[1-[(4R,10S)-4-[(4-hydroxyphenyl)methyl]-10-methyl-11-oxoundecyl]cyclopentyl]prop-2-enoic acid.
| Compound Name | 3-[1-[(4R,10S)-4-[(4-hydroxyphenyl)methyl]-10-methyl-11-oxoundecyl]cyclopentyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162998975 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 3-[1-[(4R,10S)-4-[(4-hydroxyphenyl)methyl]-10-methyl-11-oxoundecyl]cyclopentyl]prop-2-enoic acid |
| SMILES | C[C@H](C=O)CCCCC[C@H](CCCC1(C=CC(=O)O)CCCC1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H40O4/c1-22(21-28)8-3-2-4-9-23(20-24-11-13-25(29)14-12-24)10-7-18-27(16-5-6-17-27)19-15-26(30)31/h11-15,19,21-23,29H,2-10,16-18,20H2,1H3,(H,30,31)/t22-,23+/m0/s1 |
| InChIKey | IKIWPRMRWPISCL-XZOQPEGZSA-N |
| XLogP | 6.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|