C27H37N2O4- — CID 162794536
[1-carboxy-7-[(4-hydroxyphenyl)methyl]-13-methyl-14-oxotetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162794536) has the molecular formula C27H37N2O4- and a molecular weight of 453.60 g/mol. Its IUPAC name is [1-carboxy-7-[(4-hydroxyphenyl)methyl]-13-methyl-14-oxotetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [1-carboxy-7-[(4-hydroxyphenyl)methyl]-13-methyl-14-oxotetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162794536 |
| Molecular Formula | C27H37N2O4- |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | [1-carboxy-7-[(4-hydroxyphenyl)methyl]-13-methyl-14-oxotetradec-1-en-3-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | CC(C=O)CCCCCC(CCCC(C=CC(=O)O)[N-]c1ccc[nH]1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H37N2O4/c1-21(20-30)7-3-2-4-8-22(19-23-12-15-25(31)16-13-23)9-5-10-24(14-17-27(32)33)29-26-11-6-18-28-26/h6,11-18,20-22,24,28,31H,2-5,7-10,19H2,1H3,(H,32,33)/q-1 |
| InChIKey | TXEYCDPFKQHFRU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 104.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|