C25H40N2O4 — CID 163023268
(E,4S,8R,11S,14R)-11-amino-8-[(4-hydroxyphenyl)methyl]-14-methyl-4-(methylaminomethyl)-15-oxopentadec-2-enoic acid (PubChem CID 163023268) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is (E,4S,8R,11S,14R)-11-amino-8-[(4-hydroxyphenyl)methyl]-14-methyl-4-(methylaminomethyl)-15-oxopentadec-2-enoic acid.
| Compound Name | (E,4S,8R,11S,14R)-11-amino-8-[(4-hydroxyphenyl)methyl]-14-methyl-4-(methylaminomethyl)-15-oxopentadec-2-enoic acid |
|---|---|
| PubChem CID | 163023268 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | (E,4S,8R,11S,14R)-11-amino-8-[(4-hydroxyphenyl)methyl]-14-methyl-4-(methylaminomethyl)-15-oxopentadec-2-enoic acid |
| SMILES | CNC[C@H](/C=C/C(=O)O)CCCC(CC[C@H](N)CC[C@@H](C)C=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H40N2O4/c1-19(18-28)6-11-23(26)12-7-20(16-21-8-13-24(29)14-9-21)4-3-5-22(17-27-2)10-15-25(30)31/h8-10,13-15,18-20,22-23,27,29H,3-7,11-12,16-17,26H2,1-2H3,(H,30,31)/b15-10+/t19-,20?,22+,23-/m1/s1 |
| InChIKey | ZRZNCMBCKOMZLI-OKBSWDRXSA-N |
| XLogP | 3.92 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|