C25H35N3O3-2 — CID 162795384
5-[2-[5-carboxy-3-(1H-pyrrol-2-ylazanidyl)pent-4-enyl]decyl]pyridin-2-olate (PubChem CID 162795384) has the molecular formula C25H35N3O3-2 and a molecular weight of 425.57 g/mol. Its IUPAC name is 5-[2-[5-carboxy-3-(1H-pyrrol-2-ylazanidyl)pent-4-enyl]decyl]pyridin-2-olate.
| Compound Name | 5-[2-[5-carboxy-3-(1H-pyrrol-2-ylazanidyl)pent-4-enyl]decyl]pyridin-2-olate |
|---|---|
| PubChem CID | 162795384 |
| Molecular Formula | C25H35N3O3-2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 5-[2-[5-carboxy-3-(1H-pyrrol-2-ylazanidyl)pent-4-enyl]decyl]pyridin-2-olate |
| SMILES | CCCCCCCCC(CCC(C=CC(=O)O)[N-]c1ccc[nH]1)Cc1ccc([O-])nc1 |
| InChI | InChI=1S/C25H36N3O3/c1-2-3-4-5-6-7-9-20(18-21-12-15-24(29)27-19-21)11-13-22(14-16-25(30)31)28-23-10-8-17-26-23/h8,10,12,14-17,19-20,22,26H,2-7,9,11,13,18H2,1H3,(H,27,29)(H,30,31)/q-1/p-1 |
| InChIKey | JZTSREFNMVPNGK-UHFFFAOYSA-M |
| XLogP | 5.89 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|