C22H26O9 — CID 163002033
methyl (1R,2R,3S,6E,8S,9R,11S,13R,14S,17R)-8-hydroxy-17-methoxy-5-oxo-2,9-bis(prop-1-en-2-yl)-4,12,15,16-tetraoxapentacyclo[9.4.1.13,6.01,14.011,13]heptadec-6-ene-13-carboxylate (PubChem CID 163002033) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is methyl (1R,2R,3S,6E,8S,9R,11S,13R,14S,17R)-8-hydroxy-17-methoxy-5-oxo-2,9-bis(prop-1-en-2-yl)-4,12,15,16-tetraoxapentacyclo[9.4.1.13,6.01,14.011,13]heptadec-6-ene-13-carboxylate.
| Compound Name | methyl (1R,2R,3S,6E,8S,9R,11S,13R,14S,17R)-8-hydroxy-17-methoxy-5-oxo-2,9-bis(prop-1-en-2-yl)-4,12,15,16-tetraoxapentacyclo[9.4.1.13,6.01,14.011,13]heptadec-6-ene-13-carboxylate |
|---|---|
| PubChem CID | 163002033 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | methyl (1R,2R,3S,6E,8S,9R,11S,13R,14S,17R)-8-hydroxy-17-methoxy-5-oxo-2,9-bis(prop-1-en-2-yl)-4,12,15,16-tetraoxapentacyclo[9.4.1.13,6.01,14.011,13]heptadec-6-ene-13-carboxylate |
| SMILES | C=C(C)[C@H]1C[C@]23O[C@]4(O[C@H]4[C@@]2(C(=O)OC)O3)[C@H](C(=C)C)[C@@H]2OC(=O)/C(=C/[C@@H]1O)[C@H]2OC |
| InChI | InChI=1S/C22H26O9/c1-9(2)12-8-20-21(30-20,19(25)27-6)18-22(29-18,31-20)14(10(3)4)16-15(26-5)11(7-13(12)23)17(24)28-16/h7,12-16,18,23H,1,3,8H2,2,4-6H3/b11-7+/t12-,13+,14-,15-,16+,18+,20+,21+,22-/m1/s1 |
| InChIKey | UQFOGFMWZFILOP-SYTQHDKCSA-N |
| XLogP | 0.77 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|