C37H54O6 — CID 163005590
[(2S)-8-formyl-5-methoxy-2-methyl-2-(4-methyl-2-oxopent-3-enyl)-3,4-dihydrochromen-7-yl]methyl octadeca-9,12-dienoate (PubChem CID 163005590) has the molecular formula C37H54O6 and a molecular weight of 594.83 g/mol. Its IUPAC name is [(2S)-8-formyl-5-methoxy-2-methyl-2-(4-methyl-2-oxopent-3-enyl)-3,4-dihydrochromen-7-yl]methyl octadeca-9,12-dienoate.
| Compound Name | [(2S)-8-formyl-5-methoxy-2-methyl-2-(4-methyl-2-oxopent-3-enyl)-3,4-dihydrochromen-7-yl]methyl octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 163005590 |
| Molecular Formula | C37H54O6 |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | [(2S)-8-formyl-5-methoxy-2-methyl-2-(4-methyl-2-oxopent-3-enyl)-3,4-dihydrochromen-7-yl]methyl octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCc1cc(OC)c2c(c1C=O)O[C@](C)(CC(=O)C=C(C)C)CC2 |
| InChI | InChI=1S/C37H54O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-35(40)42-28-30-25-34(41-5)32-22-23-37(4,26-31(39)24-29(2)3)43-36(32)33(30)27-38/h10-11,13-14,24-25,27H,6-9,12,15-23,26,28H2,1-5H3/t37-/m0/s1 |
| InChIKey | WQODVCURNLADTH-QNGWXLTQSA-N |
| XLogP | 9.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|