C37H56O5 — CID 177474240
[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-formyl-2-hydroxy-4-methoxyphenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 177474240) has the molecular formula C37H56O5 and a molecular weight of 580.85 g/mol. Its IUPAC name is [3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-formyl-2-hydroxy-4-methoxyphenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-formyl-2-hydroxy-4-methoxyphenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 177474240 |
| Molecular Formula | C37H56O5 |
| Molecular Weight | 580.85 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | [3-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-formyl-2-hydroxy-4-methoxyphenyl]methyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCc1c(C=O)cc(OC)c(C/C=C(\C)CCC=C(C)C)c1O |
| InChI | InChI=1S/C37H56O5/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-36(39)42-29-34-32(28-38)27-35(41-5)33(37(34)40)26-25-31(4)23-21-22-30(2)3/h10-11,13-14,22,25,27-28,40H,6-9,12,15-21,23-24,26,29H2,1-5H3/b11-10-,14-13-,31-25+ |
| InChIKey | AJJWXAZANVHVTM-MZBWENGISA-N |
| XLogP | 10.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.85 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|