C31H42N2O4 — CID 163008214
3-[(1S,2R,5S,6S)-2-(1,3-benzodioxol-5-yl)-6-pentyl-5-(piperidine-1-carbonyl)cyclohex-3-en-1-yl]-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 163008214) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is 3-[(1S,2R,5S,6S)-2-(1,3-benzodioxol-5-yl)-6-pentyl-5-(piperidine-1-carbonyl)cyclohex-3-en-1-yl]-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-[(1S,2R,5S,6S)-2-(1,3-benzodioxol-5-yl)-6-pentyl-5-(piperidine-1-carbonyl)cyclohex-3-en-1-yl]-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 163008214 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 3-[(1S,2R,5S,6S)-2-(1,3-benzodioxol-5-yl)-6-pentyl-5-(piperidine-1-carbonyl)cyclohex-3-en-1-yl]-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | CCCCC[C@H]1[C@H](C=CC(=O)N2CCCC2)[C@H](c2ccc3c(c2)OCO3)C=C[C@@H]1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C31H42N2O4/c1-2-3-5-10-25-26(14-16-30(34)32-17-8-9-18-32)24(23-11-15-28-29(21-23)37-22-36-28)12-13-27(25)31(35)33-19-6-4-7-20-33/h11-16,21,24-27H,2-10,17-20,22H2,1H3/t24-,25-,26+,27-/m0/s1 |
| InChIKey | VUFKHUAQGORHEN-NFGXINMFSA-N |
| XLogP | 5.69 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|