C14H24O4 — CID 163010939
(2E,6R)-6-butoxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoic acid (PubChem CID 163010939) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2E,6R)-6-butoxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoic acid.
| Compound Name | (2E,6R)-6-butoxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoic acid |
|---|---|
| PubChem CID | 163010939 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2E,6R)-6-butoxy-2-(hydroxymethyl)-6-methylocta-2,7-dienoic acid |
| SMILES | C=C[C@@](C)(CC/C=C(\CO)C(=O)O)OCCCC |
| InChI | InChI=1S/C14H24O4/c1-4-6-10-18-14(3,5-2)9-7-8-12(11-15)13(16)17/h5,8,15H,2,4,6-7,9-11H2,1,3H3,(H,16,17)/b12-8+/t14-/m0/s1 |
| InChIKey | HDLIFVHZADXCSA-BCNIOPEESA-N |
| XLogP | 2.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|