C30H48O2 — CID 163011728
(2R,4aS,6aR,6aR,6bS,8aR,9R,12aS,14aS,14bR)-2,4a,6a,8a,9,12a,14a-heptamethyl-10-oxo-3,4,5,6,6a,6b,7,8,9,11,12,13,14,14b-tetradecahydro-1H-picene-2-carbaldehyde (PubChem CID 163011728) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (2R,4aS,6aR,6aR,6bS,8aR,9R,12aS,14aS,14bR)-2,4a,6a,8a,9,12a,14a-heptamethyl-10-oxo-3,4,5,6,6a,6b,7,8,9,11,12,13,14,14b-tetradecahydro-1H-picene-2-carbaldehyde.
| Compound Name | (2R,4aS,6aR,6aR,6bS,8aR,9R,12aS,14aS,14bR)-2,4a,6a,8a,9,12a,14a-heptamethyl-10-oxo-3,4,5,6,6a,6b,7,8,9,11,12,13,14,14b-tetradecahydro-1H-picene-2-carbaldehyde |
|---|---|
| PubChem CID | 163011728 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (2R,4aS,6aR,6aR,6bS,8aR,9R,12aS,14aS,14bR)-2,4a,6a,8a,9,12a,14a-heptamethyl-10-oxo-3,4,5,6,6a,6b,7,8,9,11,12,13,14,14b-tetradecahydro-1H-picene-2-carbaldehyde |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)[C@@H]3CC[C@@]4(C)[C@@H]5C[C@](C)(C=O)CC[C@]5(C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H48O2/c1-20-23(32)10-13-28(5)21-9-12-30(7)24-18-25(2,19-31)14-15-26(24,3)16-17-29(30,6)22(21)8-11-27(20,28)4/h19-22,24H,8-18H2,1-7H3/t20-,21+,22-,24+,25+,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | OQAIRDOMBKASNS-DTJIXMMKSA-N |
| XLogP | 7.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|