C25H36O3 — CID 163012706
(5Z)-5-[(E)-5-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-(hydroxymethyl)pent-2-enylidene]-4-methylfuran-2-one (PubChem CID 163012706) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is (5Z)-5-[(E)-5-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-(hydroxymethyl)pent-2-enylidene]-4-methylfuran-2-one.
| Compound Name | (5Z)-5-[(E)-5-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-(hydroxymethyl)pent-2-enylidene]-4-methylfuran-2-one |
|---|---|
| PubChem CID | 163012706 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (5Z)-5-[(E)-5-[(8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-(hydroxymethyl)pent-2-enylidene]-4-methylfuran-2-one |
| SMILES | CC1=CC(=O)O/C1=C\C=C(\CO)CCC1=C(C)CCC2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C25H36O3/c1-17-7-12-22-24(3,4)13-6-14-25(22,5)20(17)10-8-19(16-26)9-11-21-18(2)15-23(27)28-21/h9,11,15,22,26H,6-8,10,12-14,16H2,1-5H3/b19-9+,21-11-/t22?,25-/m1/s1 |
| InChIKey | HQIVGIMAECGREU-FIGBRXSLSA-N |
| XLogP | 6.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|