C29H44O3 — CID 11453490
[3-[(E)-5-[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-4-(methoxymethoxy)phenyl]methanol (PubChem CID 11453490) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is [3-[(E)-5-[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-4-(methoxymethoxy)phenyl]methanol.
| Compound Name | [3-[(E)-5-[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-4-(methoxymethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 11453490 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | [3-[(E)-5-[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-4-(methoxymethoxy)phenyl]methanol |
| SMILES | COCOc1ccc(CO)cc1C/C=C(\C)CCC1=C(C)CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C29H44O3/c1-21(8-12-24-18-23(19-30)11-14-26(24)32-20-31-6)9-13-25-22(2)10-15-27-28(3,4)16-7-17-29(25,27)5/h8,11,14,18,27,30H,7,9-10,12-13,15-17,19-20H2,1-6H3/b21-8+/t27-,29+/m0/s1 |
| InChIKey | ZWWVFKBJYDRXCH-XNPGRSNTSA-N |
| XLogP | 7.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|