C33H58O2Si2 — CID 71567820
[2-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane (PubChem CID 71567820) has the molecular formula C33H58O2Si2 and a molecular weight of 543.00 g/mol. Its IUPAC name is [2-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 71567820 |
| Molecular Formula | C33H58O2Si2 |
| Molecular Weight | 543.00 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | [2-[[(4aS,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxyphenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC1=C(Cc2cc(O[Si](C)(C)C(C)(C)C)ccc2O[Si](C)(C)C(C)(C)C)[C@@]2(C)CCCC(C)(C)[C@@H]2CC1 |
| InChI | InChI=1S/C33H58O2Si2/c1-24-16-19-29-32(8,9)20-15-21-33(29,10)27(24)23-25-22-26(34-36(11,12)30(2,3)4)17-18-28(25)35-37(13,14)31(5,6)7/h17-18,22,29H,15-16,19-21,23H2,1-14H3/t29-,33+/m0/s1 |
| InChIKey | ZKOCHRAQQYXKLM-RYCFQHDISA-N |
| XLogP | 10.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.00 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|