C26H42N5+ — CID 163170786
7-[5-(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8,9-dihydropurin-9-ium-6-amine (PubChem CID 163170786) has the molecular formula C26H42N5+ and a molecular weight of 424.66 g/mol. Its IUPAC name is 7-[5-(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8,9-dihydropurin-9-ium-6-amine.
| Compound Name | 7-[5-(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8,9-dihydropurin-9-ium-6-amine |
|---|---|
| PubChem CID | 163170786 |
| Molecular Formula | C26H42N5+ |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | 7-[5-(2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-methylpent-2-enyl]-9-methyl-8,9-dihydropurin-9-ium-6-amine |
| SMILES | CC(=CCN1C[NH+](C)c2ncnc(N)c21)CCC1=C(C)CCC2C(C)(C)CCCC12C |
| InChI | InChI=1S/C26H41N5/c1-18(12-15-31-17-30(6)24-22(31)23(27)28-16-29-24)8-10-20-19(2)9-11-21-25(3,4)13-7-14-26(20,21)5/h12,16,21H,7-11,13-15,17H2,1-6H3,(H2,27,28,29)/p+1 |
| InChIKey | VHLXLMQWVJKPNC-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|