C17H26O5 — CID 163013830
[(3R,6E,9E)-11-hydroperoxy-3,7,11-trimethyl-8-oxododeca-1,6,9-trien-3-yl] acetate (PubChem CID 163013830) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(3R,6E,9E)-11-hydroperoxy-3,7,11-trimethyl-8-oxododeca-1,6,9-trien-3-yl] acetate.
| Compound Name | [(3R,6E,9E)-11-hydroperoxy-3,7,11-trimethyl-8-oxododeca-1,6,9-trien-3-yl] acetate |
|---|---|
| PubChem CID | 163013830 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(3R,6E,9E)-11-hydroperoxy-3,7,11-trimethyl-8-oxododeca-1,6,9-trien-3-yl] acetate |
| SMILES | C=C[C@@](C)(CC/C=C(\C)C(=O)/C=C/C(C)(C)OO)OC(C)=O |
| InChI | InChI=1S/C17H26O5/c1-7-17(6,21-14(3)18)11-8-9-13(2)15(19)10-12-16(4,5)22-20/h7,9-10,12,20H,1,8,11H2,2-6H3/b12-10+,13-9+/t17-/m0/s1 |
| InChIKey | BCZPLJUGHXOZHA-ACDAQGQLSA-N |
| XLogP | 3.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|