C19H30O3 — CID 163087966
[(2Z,6E,10S)-10-hydroxy-2,10-dimethyldodeca-2,6,11-trienyl] (Z)-2-methylbut-2-enoate (PubChem CID 163087966) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is [(2Z,6E,10S)-10-hydroxy-2,10-dimethyldodeca-2,6,11-trienyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2Z,6E,10S)-10-hydroxy-2,10-dimethyldodeca-2,6,11-trienyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163087966 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [(2Z,6E,10S)-10-hydroxy-2,10-dimethyldodeca-2,6,11-trienyl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C[C@@](C)(O)CC/C=C/CC/C=C(/C)COC(=O)/C(C)=C\C |
| InChI | InChI=1S/C19H30O3/c1-6-17(4)18(20)22-15-16(3)13-11-9-8-10-12-14-19(5,21)7-2/h6-8,10,13,21H,2,9,11-12,14-15H2,1,3-5H3/b10-8+,16-13-,17-6-/t19-/m1/s1 |
| InChIKey | LCAYDRNPXBOYQE-UVUWXFTHSA-N |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|