C33H34O8 — CID 163015251
1-[(1R,2S,6S)-2-(3,4-dimethoxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)cyclohex-3-en-1-yl]-3-hydroxy-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dien-1-one (PubChem CID 163015251) has the molecular formula C33H34O8 and a molecular weight of 558.63 g/mol. Its IUPAC name is 1-[(1R,2S,6S)-2-(3,4-dimethoxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)cyclohex-3-en-1-yl]-3-hydroxy-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | 1-[(1R,2S,6S)-2-(3,4-dimethoxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)cyclohex-3-en-1-yl]-3-hydroxy-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 163015251 |
| Molecular Formula | C33H34O8 |
| Molecular Weight | 558.63 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 1-[(1R,2S,6S)-2-(3,4-dimethoxyphenyl)-6-(4-hydroxy-3-methoxyphenyl)cyclohex-3-en-1-yl]-3-hydroxy-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1cc(C=CC(O)=CC(=O)[C@H]2[C@@H](c3ccc(OC)c(OC)c3)C=CC[C@@H]2c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C33H34O8/c1-38-29-15-11-22(18-32(29)41-4)25-7-5-6-24(21-10-14-27(36)31(17-21)40-3)33(25)28(37)19-23(34)12-8-20-9-13-26(35)30(16-20)39-2/h5,7-19,24-25,33-36H,6H2,1-4H3/t24-,25-,33-/m1/s1 |
| InChIKey | CTLWDLSCUILOFP-WTBTXGFSSA-N |
| XLogP | 6.30 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|