C23H26O4 — CID 101465274
4-[(E)-2-[(1R,2S)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-2-methoxyphenol (PubChem CID 101465274) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[(E)-2-[(1R,2S)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-2-[(1R,2S)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 101465274 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[(E)-2-[(1R,2S)-2-(3,4-dimethoxyphenyl)cyclohex-3-en-1-yl]ethenyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=C/[C@H]2CCC=C[C@@H]2c2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C23H26O4/c1-25-21-13-11-18(15-23(21)27-3)19-7-5-4-6-17(19)10-8-16-9-12-20(24)22(14-16)26-2/h5,7-15,17,19,24H,4,6H2,1-3H3/b10-8+/t17-,19+/m1/s1 |
| InChIKey | SPFYZVLMVSWGCD-BULUQRFKSA-N |
| XLogP | 5.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|