C34H34O8 — CID 118728407
(E)-1-[(2R)-2-(3,4-dimethoxyphenyl)-1-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-3-en-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 118728407) has the molecular formula C34H34O8 and a molecular weight of 570.64 g/mol. Its IUPAC name is (E)-1-[(2R)-2-(3,4-dimethoxyphenyl)-1-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-3-en-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2R)-2-(3,4-dimethoxyphenyl)-1-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-3-en-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118728407 |
| Molecular Formula | C34H34O8 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (E)-1-[(2R)-2-(3,4-dimethoxyphenyl)-1-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]cyclohex-3-en-1-yl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)C2(C(=O)/C=C/c3ccc(O)c(OC)c3)CCC=C[C@@H]2c2ccc(OC)c(OC)c2)ccc1O |
| InChI | InChI=1S/C34H34O8/c1-39-28-15-12-24(21-31(28)42-4)25-7-5-6-18-34(25,32(37)16-10-22-8-13-26(35)29(19-22)40-2)33(38)17-11-23-9-14-27(36)30(20-23)41-3/h5,7-17,19-21,25,35-36H,6,18H2,1-4H3/b16-10+,17-11+/t25-/m1/s1 |
| InChIKey | DNDGEKQXGPRAKE-AZSFKJRMSA-N |
| XLogP | 6.12 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|