C29H30O15 — CID 163024086
[(2R,3S,4S,5R,6S)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,4,5-trihydroxyoxan-2-yl]methyl (3S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-2-methylidenebutanoate (PubChem CID 163024086) has the molecular formula C29H30O15 and a molecular weight of 618.54 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,4,5-trihydroxyoxan-2-yl]methyl (3S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-2-methylidenebutanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,4,5-trihydroxyoxan-2-yl]methyl (3S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 163024086 |
| Molecular Formula | C29H30O15 |
| Molecular Weight | 618.54 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3,4,5-trihydroxyoxan-2-yl]methyl (3S)-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC[C@H]1O[C@@H](OC(=O)C=Cc2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O)[C@H](O)COC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H30O15/c1-14(21(34)12-41-23(35)8-4-15-2-6-17(30)19(32)10-15)28(40)42-13-22-25(37)26(38)27(39)29(43-22)44-24(36)9-5-16-3-7-18(31)20(33)11-16/h2-11,21-22,25-27,29-34,37-39H,1,12-13H2/t21-,22-,25-,26+,27-,29+/m1/s1 |
| InChIKey | YNHXTZRTUPWAEO-WVLMKCPISA-N |
| XLogP | -0.41 |
| TPSA | 249.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.54 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|