C22H30O7 — CID 163025714
(13-hydroxy-16-methoxy-2,11,12-trimethyl-6-oxo-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1-en-5-yl)methyl acetate (PubChem CID 163025714) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is (13-hydroxy-16-methoxy-2,11,12-trimethyl-6-oxo-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1-en-5-yl)methyl acetate.
| Compound Name | (13-hydroxy-16-methoxy-2,11,12-trimethyl-6-oxo-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1-en-5-yl)methyl acetate |
|---|---|
| PubChem CID | 163025714 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (13-hydroxy-16-methoxy-2,11,12-trimethyl-6-oxo-7,17-dioxapentacyclo[10.3.1.13,15.05,15.08,13]heptadec-1-en-5-yl)methyl acetate |
| SMILES | COC1C2=C(C)C3CC4(COC(C)=O)C(=O)OC5CCC(C)C1(C)C5(O)CC24O3 |
| InChI | InChI=1S/C22H30O7/c1-11-6-7-15-21(25)9-22-16(17(26-5)19(11,21)4)12(2)14(29-22)8-20(22,18(24)28-15)10-27-13(3)23/h11,14-15,17,25H,6-10H2,1-5H3 |
| InChIKey | QXNJAAXCUBDQFV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|