C18H21NO — CID 163026154
1-pyrrolidin-1-yltetradeca-2,4,12-trien-8,10-diyn-1-one (PubChem CID 163026154) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-pyrrolidin-1-yltetradeca-2,4,12-trien-8,10-diyn-1-one.
| Compound Name | 1-pyrrolidin-1-yltetradeca-2,4,12-trien-8,10-diyn-1-one |
|---|---|
| PubChem CID | 163026154 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-pyrrolidin-1-yltetradeca-2,4,12-trien-8,10-diyn-1-one |
| SMILES | CC=CC#CC#CCCC=CC=CC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H21NO/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(20)19-16-13-14-17-19/h2-3,10-12,15H,8-9,13-14,16-17H2,1H3 |
| InChIKey | XKCLCATWJFCVNH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|