C15H18O5 — CID 163028767
(1R,9R,10S,11R,13R,14S)-10,14-dihydroxy-1,6,10-trimethyl-4,12-dioxatetracyclo[7.5.0.03,7.011,13]tetradeca-2,6-dien-5-one (PubChem CID 163028767) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1R,9R,10S,11R,13R,14S)-10,14-dihydroxy-1,6,10-trimethyl-4,12-dioxatetracyclo[7.5.0.03,7.011,13]tetradeca-2,6-dien-5-one.
| Compound Name | (1R,9R,10S,11R,13R,14S)-10,14-dihydroxy-1,6,10-trimethyl-4,12-dioxatetracyclo[7.5.0.03,7.011,13]tetradeca-2,6-dien-5-one |
|---|---|
| PubChem CID | 163028767 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1R,9R,10S,11R,13R,14S)-10,14-dihydroxy-1,6,10-trimethyl-4,12-dioxatetracyclo[7.5.0.03,7.011,13]tetradeca-2,6-dien-5-one |
| SMILES | CC1=C2C[C@H]3[C@](C)(O)[C@@H]4O[C@@H]4[C@@H](O)[C@]3(C)C=C2OC1=O |
| InChI | InChI=1S/C15H18O5/c1-6-7-4-9-14(2,5-8(7)19-13(6)17)11(16)10-12(20-10)15(9,3)18/h5,9-12,16,18H,4H2,1-3H3/t9-,10-,11-,12-,14-,15+/m1/s1 |
| InChIKey | GFMJLPQUCLMOST-HTKHVQBFSA-N |
| XLogP | 0.66 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|