C18H32O3 — CID 163031378
7,10-dibutoxydeca-1,4-dien-3-one (PubChem CID 163031378) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 7,10-dibutoxydeca-1,4-dien-3-one.
| Compound Name | 7,10-dibutoxydeca-1,4-dien-3-one |
|---|---|
| PubChem CID | 163031378 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 7,10-dibutoxydeca-1,4-dien-3-one |
| SMILES | C=CC(=O)C=CCC(CCCOCCCC)OCCCC |
| InChI | InChI=1S/C18H32O3/c1-4-7-14-20-15-10-13-18(21-16-8-5-2)12-9-11-17(19)6-3/h6,9,11,18H,3-5,7-8,10,12-16H2,1-2H3 |
| InChIKey | HGIXWNAQTIRBRE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|