C31H58O5 — CID 163057517
1,4,12,15-tetrabutoxypentadeca-6,9-dien-8-one (PubChem CID 163057517) has the molecular formula C31H58O5 and a molecular weight of 510.80 g/mol. Its IUPAC name is 1,4,12,15-tetrabutoxypentadeca-6,9-dien-8-one.
| Compound Name | 1,4,12,15-tetrabutoxypentadeca-6,9-dien-8-one |
|---|---|
| PubChem CID | 163057517 |
| Molecular Formula | C31H58O5 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.43 |
| IUPAC Name | 1,4,12,15-tetrabutoxypentadeca-6,9-dien-8-one |
| SMILES | CCCCOCCCC(CC=CC(=O)C=CCC(CCCOCCCC)OCCCC)OCCCC |
| InChI | InChI=1S/C31H58O5/c1-5-9-23-33-25-15-21-30(35-27-11-7-3)19-13-17-29(32)18-14-20-31(36-28-12-8-4)22-16-26-34-24-10-6-2/h13-14,17-18,30-31H,5-12,15-16,19-28H2,1-4H3 |
| InChIKey | HBZDBFHZNHYJPY-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|