C18H23NO — CID 163031463
1-pyrrolidin-1-yltetradeca-2,4-dien-8,10-diyn-1-one (PubChem CID 163031463) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-pyrrolidin-1-yltetradeca-2,4-dien-8,10-diyn-1-one.
| Compound Name | 1-pyrrolidin-1-yltetradeca-2,4-dien-8,10-diyn-1-one |
|---|---|
| PubChem CID | 163031463 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1-pyrrolidin-1-yltetradeca-2,4-dien-8,10-diyn-1-one |
| SMILES | CCCC#CC#CCCC=CC=CC(=O)N1CCCC1 |
| InChI | InChI=1S/C18H23NO/c1-2-3-4-5-6-7-8-9-10-11-12-15-18(20)19-16-13-14-17-19/h10-12,15H,2-3,8-9,13-14,16-17H2,1H3 |
| InChIKey | LBTCUMZRXYUDKA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|