C20H14O6 — CID 163036541
(9S,10R,11R,12R,14S)-5,9,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,16,18-hexaene-7,15-dione (PubChem CID 163036541) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is (9S,10R,11R,12R,14S)-5,9,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,16,18-hexaene-7,15-dione.
| Compound Name | (9S,10R,11R,12R,14S)-5,9,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,16,18-hexaene-7,15-dione |
|---|---|
| PubChem CID | 163036541 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (9S,10R,11R,12R,14S)-5,9,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,16,18-hexaene-7,15-dione |
| SMILES | O=C1C[C@H](O)[C@H]2c3c(ccc(O)c31)-c1ccc(O)c3c1[C@@H]2[C@H]1O[C@@H]1C3=O |
| InChI | InChI=1S/C20H14O6/c21-8-3-1-6-7-2-4-9(22)16-13(7)17(19-20(26-19)18(16)25)15-11(24)5-10(23)14(8)12(6)15/h1-4,11,15,17,19-22,24H,5H2/t11-,15-,17-,19+,20+/m0/s1 |
| InChIKey | JHMQRCUWXPACCR-WBCQHXHDSA-N |
| XLogP | 1.86 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|